C25H30N2O4 — CID 70839620
5-[[2-[(4-butoxy-3-methylquinolin-2-yl)methoxy]-4-pyridinyl]oxy]pentan-2-one (PubChem CID 70839620) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-[[2-[(4-butoxy-3-methylquinolin-2-yl)methoxy]-4-pyridinyl]oxy]pentan-2-one.
| Compound Name | 5-[[2-[(4-butoxy-3-methylquinolin-2-yl)methoxy]-4-pyridinyl]oxy]pentan-2-one |
|---|---|
| PubChem CID | 70839620 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-[[2-[(4-butoxy-3-methylquinolin-2-yl)methoxy]-4-pyridinyl]oxy]pentan-2-one |
| SMILES | CCCCOc1c(C)c(COc2cc(OCCCC(C)=O)ccn2)nc2ccccc12 |
| InChI | InChI=1S/C25H30N2O4/c1-4-5-14-30-25-19(3)23(27-22-11-7-6-10-21(22)25)17-31-24-16-20(12-13-26-24)29-15-8-9-18(2)28/h6-7,10-13,16H,4-5,8-9,14-15,17H2,1-3H3 |
| InChIKey | NLLATWBKUADJRF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|