C24H26Cl2N2O3 — CID 70839537
(4-butoxy-3-methylquinolin-2-yl)methyl N-[2-(3,4-dichlorophenyl)ethyl]carbamate (PubChem CID 70839537) has the molecular formula C24H26Cl2N2O3 and a molecular weight of 461.39 g/mol. Its IUPAC name is (4-butoxy-3-methylquinolin-2-yl)methyl N-[2-(3,4-dichlorophenyl)ethyl]carbamate.
| Compound Name | (4-butoxy-3-methylquinolin-2-yl)methyl N-[2-(3,4-dichlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 70839537 |
| Molecular Formula | C24H26Cl2N2O3 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (4-butoxy-3-methylquinolin-2-yl)methyl N-[2-(3,4-dichlorophenyl)ethyl]carbamate |
| SMILES | CCCCOc1c(C)c(COC(=O)NCCc2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C24H26Cl2N2O3/c1-3-4-13-30-23-16(2)22(28-21-8-6-5-7-18(21)23)15-31-24(29)27-12-11-17-9-10-19(25)20(26)14-17/h5-10,14H,3-4,11-13,15H2,1-2H3,(H,27,29) |
| InChIKey | OSTXDGRJLGRIPM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|