C19H18FNO — CID 174766627
2,4-diethyl-3-(4-fluorophenoxy)quinoline (PubChem CID 174766627) has the molecular formula C19H18FNO and a molecular weight of 295.36 g/mol. Its IUPAC name is 2,4-diethyl-3-(4-fluorophenoxy)quinoline.
| Compound Name | 2,4-diethyl-3-(4-fluorophenoxy)quinoline |
|---|---|
| PubChem CID | 174766627 |
| Molecular Formula | C19H18FNO |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2,4-diethyl-3-(4-fluorophenoxy)quinoline |
| SMILES | CCc1nc2ccccc2c(CC)c1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FNO/c1-3-15-16-7-5-6-8-18(16)21-17(4-2)19(15)22-14-11-9-13(20)10-12-14/h5-12H,3-4H2,1-2H3 |
| InChIKey | VUIZCFFDUIULFK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |