C44H35N5O3 — CID 23298239
2-ethyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylic acid (PubChem CID 23298239) has the molecular formula C44H35N5O3 and a molecular weight of 681.80 g/mol. Its IUPAC name is 2-ethyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylic acid.
| Compound Name | 2-ethyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 23298239 |
| Molecular Formula | C44H35N5O3 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | 2-ethyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylic acid |
| SMILES | CCc1nc2ccccc2c(C(=O)O)c1Oc1ccc(-c2ccccc2C2=NNN(C(c3ccccc3)(c3ccccc3)c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C44H35N5O3/c1-2-38-41(40(43(50)51)37-24-14-15-25-39(37)45-38)52-34-28-26-30(27-29-34)35-22-12-13-23-36(35)42-46-48-49(47-42)44(31-16-6-3-7-17-31,32-18-8-4-9-19-32)33-20-10-5-11-21-33/h3-29,48H,2H2,1H3,(H,46,47)(H,50,51) |
| InChIKey | VNLHFFJQAYVHRB-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|