C54H51N5O5 — CID 57022245
[1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] 2-propyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate (PubChem CID 57022245) has the molecular formula C54H51N5O5 and a molecular weight of 850.03 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] 2-propyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate.
| Compound Name | [1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] 2-propyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 57022245 |
| Molecular Formula | C54H51N5O5 |
| Molecular Weight | 850.03 g/mol |
| Exact Mass | 849.39 |
| IUPAC Name | [1-(2,2-dimethylpropanoyloxy)-2-methylpropyl] 2-propyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate |
| SMILES | CCCc1nc2ccccc2c(C(=O)OC(OC(=O)C(C)(C)C)C(C)C)c1Oc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C54H51N5O5/c1-7-21-46-48(47(44-30-19-20-31-45(44)55-46)50(60)63-51(36(2)3)64-52(61)53(4,5)6)62-41-34-32-37(33-35-41)42-28-17-18-29-43(42)49-56-58-59(57-49)54(38-22-11-8-12-23-38,39-24-13-9-14-25-39)40-26-15-10-16-27-40/h8-20,22-36,51H,7,21H2,1-6H3 |
| InChIKey | WQNJRGWCJFOXEL-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 118.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.03 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|