C44H44N6O2 — CID 67756670
methyl 2-butyl-5-ethyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,5-dihydropyrazole-4-carboxylate (PubChem CID 67756670) has the molecular formula C44H44N6O2 and a molecular weight of 688.88 g/mol. Its IUPAC name is methyl 2-butyl-5-ethyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,5-dihydropyrazole-4-carboxylate.
| Compound Name | methyl 2-butyl-5-ethyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,5-dihydropyrazole-4-carboxylate |
|---|---|
| PubChem CID | 67756670 |
| Molecular Formula | C44H44N6O2 |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | methyl 2-butyl-5-ethyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,5-dihydropyrazole-4-carboxylate |
| SMILES | CCCCN1NC(CC)C(C(=O)OC)=C1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H44N6O2/c1-4-6-30-49-40(41(43(51)52-3)39(5-2)46-49)31-32-26-28-33(29-27-32)37-24-16-17-25-38(37)42-45-48-50(47-42)44(34-18-10-7-11-19-34,35-20-12-8-13-21-35)36-22-14-9-15-23-36/h7-29,39,46H,4-6,30-31H2,1-3H3 |
| InChIKey | OENFCFMUFUAVOZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|