C45H43N7O2 — CID 10259262
ethyl 2-butyl-4-[methyl-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate (PubChem CID 10259262) has the molecular formula C45H43N7O2 and a molecular weight of 713.89 g/mol. Its IUPAC name is ethyl 2-butyl-4-[methyl-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-butyl-4-[methyl-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10259262 |
| Molecular Formula | C45H43N7O2 |
| Molecular Weight | 713.89 g/mol |
| Exact Mass | 713.35 |
| IUPAC Name | ethyl 2-butyl-4-[methyl-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate |
| SMILES | CCCCc1ncc(C(=O)OCC)c(N(C)Cc2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)n1 |
| InChI | InChI=1S/C45H43N7O2/c1-4-6-26-41-46-31-40(44(53)54-5-2)43(47-41)51(3)32-33-27-29-34(30-28-33)38-24-16-17-25-39(38)42-48-50-52(49-42)45(35-18-10-7-11-19-35,36-20-12-8-13-21-36)37-22-14-9-15-23-37/h7-25,27-31H,4-6,26,32H2,1-3H3 |
| InChIKey | PPTLVRQNHHAQCO-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.89 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|