C47H46N6O2 — CID 57236522
2,6-dibutyl-4-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyridine-3-carboxamide (PubChem CID 57236522) has the molecular formula C47H46N6O2 and a molecular weight of 726.93 g/mol. Its IUPAC name is 2,6-dibutyl-4-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyridine-3-carboxamide.
| Compound Name | 2,6-dibutyl-4-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57236522 |
| Molecular Formula | C47H46N6O2 |
| Molecular Weight | 726.93 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | 2,6-dibutyl-4-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyridine-3-carboxamide |
| SMILES | CCCCc1cc(OCc2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)c(C(N)=O)c(CCCC)n1 |
| InChI | InChI=1S/C47H46N6O2/c1-3-5-24-39-32-43(44(45(48)54)42(49-39)27-6-4-2)55-33-34-28-30-35(31-29-34)40-25-16-17-26-41(40)46-50-52-53(51-46)47(36-18-10-7-11-19-36,37-20-12-8-13-21-37)38-22-14-9-15-23-38/h7-23,25-26,28-32H,3-6,24,27,33H2,1-2H3,(H2,48,54) |
| InChIKey | SGMSDCQLURJLRU-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.93 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|