C64H58ClN7O3 — CID 57409568
3-[3,4-bis(phenylmethoxy)phenyl]-N-[[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]propanamide (PubChem CID 57409568) has the molecular formula C64H58ClN7O3 and a molecular weight of 1008.67 g/mol. Its IUPAC name is 3-[3,4-bis(phenylmethoxy)phenyl]-N-[[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]propanamide.
| Compound Name | 3-[3,4-bis(phenylmethoxy)phenyl]-N-[[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 57409568 |
| Molecular Formula | C64H58ClN7O3 |
| Molecular Weight | 1008.67 g/mol |
| Exact Mass | 1007.43 |
| IUPAC Name | 3-[3,4-bis(phenylmethoxy)phenyl]-N-[[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]propanamide |
| SMILES | CCCCc1nc(Cl)c(CNC(=O)CCc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)n1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C64H58ClN7O3/c1-2-3-33-60-67-62(65)57(43-66-61(73)41-37-47-36-40-58(74-45-49-21-9-4-10-22-49)59(42-47)75-46-50-23-11-5-12-24-50)71(60)44-48-34-38-51(39-35-48)55-31-19-20-32-56(55)63-68-70-72(69-63)64(52-25-13-6-14-26-52,53-27-15-7-16-28-53)54-29-17-8-18-30-54/h4-32,34-36,38-40,42H,2-3,33,37,41,43-46H2,1H3,(H,66,73) |
| InChIKey | CPHFSXMFQYCWOB-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.67 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|