C40H36N6 — CID 10054317
5-[2-[4-[(4-butylimidazol-1-yl)methyl]phenyl]phenyl]-2-trityltetrazole (PubChem CID 10054317) has the molecular formula C40H36N6 and a molecular weight of 600.77 g/mol. Its IUPAC name is 5-[2-[4-[(4-butylimidazol-1-yl)methyl]phenyl]phenyl]-2-trityltetrazole.
| Compound Name | 5-[2-[4-[(4-butylimidazol-1-yl)methyl]phenyl]phenyl]-2-trityltetrazole |
|---|---|
| PubChem CID | 10054317 |
| Molecular Formula | C40H36N6 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | 5-[2-[4-[(4-butylimidazol-1-yl)methyl]phenyl]phenyl]-2-trityltetrazole |
| SMILES | CCCCc1cn(Cc2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)cn1 |
| InChI | InChI=1S/C40H36N6/c1-2-3-21-36-29-45(30-41-36)28-31-24-26-32(27-25-31)37-22-13-14-23-38(37)39-42-44-46(43-39)40(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35/h4-20,22-27,29-30H,2-3,21,28H2,1H3 |
| InChIKey | AMSXAEJLQNGULO-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|