C43H37N7O — CID 24828971
6-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[3,4-b]pyridin-3-one (PubChem CID 24828971) has the molecular formula C43H37N7O and a molecular weight of 667.82 g/mol. Its IUPAC name is 6-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 24828971 |
| Molecular Formula | C43H37N7O |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | 6-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[3,4-b]pyridin-3-one |
| SMILES | CCCn1c(=O)c2ccc(C)nc2n1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C43H37N7O/c1-3-29-48-42(51)39-28-23-31(2)44-41(39)49(48)30-32-24-26-33(27-25-32)37-21-13-14-22-38(37)40-45-47-50(46-40)43(34-15-7-4-8-16-34,35-17-9-5-10-18-35)36-19-11-6-12-20-36/h4-28H,3,29-30H2,1-2H3 |
| InChIKey | DEHSLDFJUMAKLP-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|