C54H46N8 — CID 54371067
6-(1-benzylimidazol-4-yl)-4-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole (PubChem CID 54371067) has the molecular formula C54H46N8 and a molecular weight of 807.02 g/mol. Its IUPAC name is 6-(1-benzylimidazol-4-yl)-4-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole.
| Compound Name | 6-(1-benzylimidazol-4-yl)-4-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 54371067 |
| Molecular Formula | C54H46N8 |
| Molecular Weight | 807.02 g/mol |
| Exact Mass | 806.38 |
| IUPAC Name | 6-(1-benzylimidazol-4-yl)-4-methyl-2-propyl-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole |
| SMILES | CCCc1nc2c(C)cc(-c3cn(Cc4ccccc4)cn3)cc2n1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C54H46N8/c1-3-18-51-56-52-39(2)33-43(49-37-60(38-55-49)35-40-19-8-4-9-20-40)34-50(52)61(51)36-41-29-31-42(32-30-41)47-27-16-17-28-48(47)53-57-59-62(58-53)54(44-21-10-5-11-22-44,45-23-12-6-13-24-45)46-25-14-7-15-26-46/h4-17,19-34,37-38H,3,18,35-36H2,1-2H3 |
| InChIKey | UTFWSUQBVKGRRB-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.02 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|