C34H37N5O3 — CID 67713827
butyl 2-[4-[[6-[1-(2-amino-2-oxoethyl)imidazol-4-yl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 67713827) has the molecular formula C34H37N5O3 and a molecular weight of 563.70 g/mol. Its IUPAC name is butyl 2-[4-[[6-[1-(2-amino-2-oxoethyl)imidazol-4-yl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | butyl 2-[4-[[6-[1-(2-amino-2-oxoethyl)imidazol-4-yl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 67713827 |
| Molecular Formula | C34H37N5O3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | butyl 2-[4-[[6-[1-(2-amino-2-oxoethyl)imidazol-4-yl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1-c1ccc(Cn2c(CCC)nc3c(C)cc(-c4cn(CC(N)=O)cn4)cc32)cc1 |
| InChI | InChI=1S/C34H37N5O3/c1-4-6-16-42-34(41)28-11-8-7-10-27(28)25-14-12-24(13-15-25)19-39-30-18-26(29-20-38(22-36-29)21-31(35)40)17-23(3)33(30)37-32(39)9-5-2/h7-8,10-15,17-18,20,22H,4-6,9,16,19,21H2,1-3H3,(H2,35,40) |
| InChIKey | SGRAAYPSOLMVKO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|