C37H37N5O5S — CID 11377325
2-(2-nitrooxyethylsulfanyl)ethyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 11377325) has the molecular formula C37H37N5O5S and a molecular weight of 663.80 g/mol. Its IUPAC name is 2-(2-nitrooxyethylsulfanyl)ethyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | 2-(2-nitrooxyethylsulfanyl)ethyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11377325 |
| Molecular Formula | C37H37N5O5S |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 2-(2-nitrooxyethylsulfanyl)ethyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)OCCSCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C37H37N5O5S/c1-4-9-34-39-35-25(2)22-28(36-38-31-12-7-8-13-32(31)40(36)3)23-33(35)41(34)24-26-14-16-27(17-15-26)29-10-5-6-11-30(29)37(43)46-18-20-48-21-19-47-42(44)45/h5-8,10-17,22-23H,4,9,18-21,24H2,1-3H3 |
| InChIKey | UOVHHBVVIRLEJU-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 114.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|