C42H46N5O3 — CID 50991152
CID 50991152 (PubChem CID 50991152) has the molecular formula C42H46N5O3 and a molecular weight of 668.86 g/mol.
| Compound Name | CID 50991152 |
|---|---|
| PubChem CID | 50991152 |
| Molecular Formula | C42H46N5O3 |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | — |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)cc1 |
| InChI | InChI=1S/C42H46N5O3/c1-8-13-37-44-38-27(2)22-30(39-43-34-16-11-12-17-35(34)45(39)7)23-36(38)46(37)26-28-18-20-29(21-19-28)32-14-9-10-15-33(32)40(48)50-31-24-41(3,4)47(49)42(5,6)25-31/h9-12,14-23,31H,8,13,24-26H2,1-7H3 |
| InChIKey | HOTKVXDHURVWJE-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 85.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |