C42H41N5O8 — CID 44816606
[5-[(4R)-4-nitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 44816606) has the molecular formula C42H41N5O8 and a molecular weight of 743.82 g/mol. Its IUPAC name is [5-[(4R)-4-nitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | [5-[(4R)-4-nitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 44816606 |
| Molecular Formula | C42H41N5O8 |
| Molecular Weight | 743.82 g/mol |
| Exact Mass | 743.30 |
| IUPAC Name | [5-[(4R)-4-nitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)OCc2oc(=O)oc2CCC[C@@H](C)O[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C42H41N5O8/c1-5-11-38-44-39-26(2)22-30(40-43-33-15-8-9-16-34(33)45(40)4)23-35(39)46(38)24-28-18-20-29(21-19-28)31-13-6-7-14-32(31)41(48)52-25-37-36(53-42(49)54-37)17-10-12-27(3)55-47(50)51/h6-9,13-16,18-23,27H,5,10-12,17,24-25H2,1-4H3/t27-/m1/s1 |
| InChIKey | UBZFXPOPBSNSTE-HHHXNRCGSA-N |
| XLogP | 8.39 |
| TPSA | 157.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.82 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|