C32H38N4O3 — CID 70050532
2-[4-[[6-[(2-amino-2-oxoethyl)-pentylamino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 70050532) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-[4-[[6-[(2-amino-2-oxoethyl)-pentylamino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[6-[(2-amino-2-oxoethyl)-pentylamino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 70050532 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 2-[4-[[6-[(2-amino-2-oxoethyl)-pentylamino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCN(CC(N)=O)c1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2c1 |
| InChI | InChI=1S/C32H38N4O3/c1-4-6-9-17-35(21-29(33)37)25-18-22(3)31-28(19-25)36(30(34-31)10-5-2)20-23-13-15-24(16-14-23)26-11-7-8-12-27(26)32(38)39/h7-8,11-16,18-19H,4-6,9-10,17,20-21H2,1-3H3,(H2,33,37)(H,38,39) |
| InChIKey | ZRSDGPWTJABQQY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|