C31H36N4O3 — CID 70051522
2-[4-[[6-[carbamoyl(pentyl)amino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 70051522) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 2-[4-[[6-[carbamoyl(pentyl)amino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[6-[carbamoyl(pentyl)amino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 70051522 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-[4-[[6-[carbamoyl(pentyl)amino]-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCN(C(N)=O)c1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2c1 |
| InChI | InChI=1S/C31H36N4O3/c1-4-6-9-17-34(31(32)38)24-18-21(3)29-27(19-24)35(28(33-29)10-5-2)20-22-13-15-23(16-14-22)25-11-7-8-12-26(25)30(36)37/h7-8,11-16,18-19H,4-6,9-10,17,20H2,1-3H3,(H2,32,38)(H,36,37) |
| InChIKey | SRMQTFLBCRFENK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|