C43H35F5N6O2 — CID 10908851
methyl 5-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 10908851) has the molecular formula C43H35F5N6O2 and a molecular weight of 762.78 g/mol. Its IUPAC name is methyl 5-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 10908851 |
| Molecular Formula | C43H35F5N6O2 |
| Molecular Weight | 762.78 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | methyl 5-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(C(F)(F)C(F)(F)F)c(C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C43H35F5N6O2/c1-3-15-36-49-38(42(44,45)43(46,47)48)37(40(55)56-2)53(36)28-29-24-26-30(27-25-29)34-22-13-14-23-35(34)39-50-52-54(51-39)41(31-16-7-4-8-17-31,32-18-9-5-10-19-32)33-20-11-6-12-21-33/h4-14,16-27H,3,15,28H2,1-2H3 |
| InChIKey | RASLTBPXFQXDMQ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.78 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|