C52H49ClN8O2 — CID 15222093
methyl 5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 15222093) has the molecular formula C52H49ClN8O2 and a molecular weight of 853.47 g/mol. Its IUPAC name is methyl 5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 15222093 |
| Molecular Formula | C52H49ClN8O2 |
| Molecular Weight | 853.47 g/mol |
| Exact Mass | 852.37 |
| IUPAC Name | methyl 5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(CN2CCN(c3ccccc3Cl)CC2)c(C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H49ClN8O2/c1-3-17-48-54-46(37-58-32-34-59(35-33-58)47-27-16-15-26-45(47)53)49(51(62)63-2)60(48)36-38-28-30-39(31-29-38)43-24-13-14-25-44(43)50-55-56-57-61(50)52(40-18-7-4-8-19-40,41-20-9-5-10-21-41)42-22-11-6-12-23-42/h4-16,18-31H,3,17,32-37H2,1-2H3 |
| InChIKey | RJCITZWWCCUCPC-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 94.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.47 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|