C53H52N8O3 — CID 15222089
methyl 5-[[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 15222089) has the molecular formula C53H52N8O3 and a molecular weight of 849.05 g/mol. Its IUPAC name is methyl 5-[[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-[[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 15222089 |
| Molecular Formula | C53H52N8O3 |
| Molecular Weight | 849.05 g/mol |
| Exact Mass | 848.42 |
| IUPAC Name | methyl 5-[[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(CN2CCN(c3cccc(OC)c3)CC2)c(C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C53H52N8O3/c1-4-17-49-54-48(38-58-32-34-59(35-33-58)44-24-16-25-45(36-44)63-2)50(52(62)64-3)60(49)37-39-28-30-40(31-29-39)46-26-14-15-27-47(46)51-55-56-57-61(51)53(41-18-8-5-9-19-41,42-20-10-6-11-21-42)43-22-12-7-13-23-43/h5-16,18-31,36H,4,17,32-35,37-38H2,1-3H3 |
| InChIKey | NOTYVYSXYFUKGT-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 103.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.05 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|