C44H38N7O3- — CID 86752767
5-(2-methylprop-2-enoylamino)-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 86752767) has the molecular formula C44H38N7O3- and a molecular weight of 712.83 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoylamino)-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 5-(2-methylprop-2-enoylamino)-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 86752767 |
| Molecular Formula | C44H38N7O3- |
| Molecular Weight | 712.83 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 5-(2-methylprop-2-enoylamino)-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | C=C(C)C(=O)Nc1nc(CCC)n(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c1C(=O)[O-] |
| InChI | InChI=1S/C44H39N7O3/c1-4-16-38-45-40(46-42(52)30(2)3)39(43(53)54)50(38)29-31-25-27-32(28-26-31)36-23-14-15-24-37(36)41-47-48-49-51(41)44(33-17-8-5-9-18-33,34-19-10-6-11-20-34)35-21-12-7-13-22-35/h5-15,17-28H,2,4,16,29H2,1,3H3,(H,46,52)(H,53,54)/p-1 |
| InChIKey | FHQVWQURNAOSSM-UHFFFAOYSA-M |
| XLogP | 6.92 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.83 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|