C48H49N7O3 — CID 154421947
methyl 5-[(3,5-dimethylmorpholin-4-yl)methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 154421947) has the molecular formula C48H49N7O3 and a molecular weight of 771.97 g/mol. Its IUPAC name is methyl 5-[(3,5-dimethylmorpholin-4-yl)methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-[(3,5-dimethylmorpholin-4-yl)methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 154421947 |
| Molecular Formula | C48H49N7O3 |
| Molecular Weight | 771.97 g/mol |
| Exact Mass | 771.39 |
| IUPAC Name | methyl 5-[(3,5-dimethylmorpholin-4-yl)methyl]-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCc1nc(CN2C(C)COCC2C)c(C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H49N7O3/c1-5-17-44-49-43(31-53-34(2)32-58-33-35(53)3)45(47(56)57-4)54(44)30-36-26-28-37(29-27-36)41-24-15-16-25-42(41)46-50-51-52-55(46)48(38-18-9-6-10-19-38,39-20-11-7-12-21-39)40-22-13-8-14-23-40/h6-16,18-29,34-35H,5,17,30-33H2,1-4H3 |
| InChIKey | ZZYGDTFLLBJNRX-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 100.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.97 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|