C49H40BrN7 — CID 167346351
3-[[4-[5-(4-bromophenyl)-2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 167346351) has the molecular formula C49H40BrN7 and a molecular weight of 806.81 g/mol. Its IUPAC name is 3-[[4-[5-(4-bromophenyl)-2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 3-[[4-[5-(4-bromophenyl)-2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 167346351 |
| Molecular Formula | C49H40BrN7 |
| Molecular Weight | 806.81 g/mol |
| Exact Mass | 805.25 |
| IUPAC Name | 3-[[4-[5-(4-bromophenyl)-2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2cc(-c3ccc(Br)cc3)ccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C49H40BrN7/c1-4-45-52-46-33(2)30-34(3)51-48(46)56(45)32-35-20-22-37(23-21-35)44-31-38(36-24-27-42(50)28-25-36)26-29-43(44)47-53-55-57(54-47)49(39-14-8-5-9-15-39,40-16-10-6-11-17-40)41-18-12-7-13-19-41/h5-31H,4,32H2,1-3H3 |
| InChIKey | OZDDSQADFPVREP-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.81 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|