C45H36BrN7O2 — CID 67824680
[3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-7-methylimidazo[4,5-b]pyridin-5-yl]methanol (PubChem CID 67824680) has the molecular formula C45H36BrN7O2 and a molecular weight of 786.73 g/mol. Its IUPAC name is [3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-7-methylimidazo[4,5-b]pyridin-5-yl]methanol.
| Compound Name | [3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-7-methylimidazo[4,5-b]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 67824680 |
| Molecular Formula | C45H36BrN7O2 |
| Molecular Weight | 786.73 g/mol |
| Exact Mass | 785.21 |
| IUPAC Name | [3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-7-methylimidazo[4,5-b]pyridin-5-yl]methanol |
| SMILES | CCc1nc2c(C)cc(CO)nc2n1Cc1c2ccocc-2c(Br)c1-c1ccccc1-c1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C45H36BrN7O2/c1-3-39-48-42-29(2)25-33(27-54)47-44(42)52(39)26-37-34-23-24-55-28-38(34)41(46)40(37)35-21-13-14-22-36(35)43-49-51-53(50-43)45(30-15-7-4-8-16-30,31-17-9-5-10-18-31)32-19-11-6-12-20-32/h4-25,28,54H,3,26-27H2,1-2H3 |
| InChIKey | JZQIYMXYHJBBRE-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.73 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|