C42H33BrN6O3 — CID 67823051
ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-5-methylimidazole-4-carboxylate (PubChem CID 67823051) has the molecular formula C42H33BrN6O3 and a molecular weight of 749.67 g/mol. Its IUPAC name is ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-5-methylimidazole-4-carboxylate.
| Compound Name | ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-5-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 67823051 |
| Molecular Formula | C42H33BrN6O3 |
| Molecular Weight | 749.67 g/mol |
| Exact Mass | 748.18 |
| IUPAC Name | ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-5-methylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)ncn1Cc1c2ccocc-2c(Br)c1-c1ccccc1-c1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C42H33BrN6O3/c1-3-52-41(50)39-28(2)44-27-48(39)25-35-32-23-24-51-26-36(32)38(43)37(35)33-21-13-14-22-34(33)40-45-47-49(46-40)42(29-15-7-4-8-16-29,30-17-9-5-10-18-30)31-19-11-6-12-20-31/h4-24,26-27H,3,25H2,1-2H3 |
| InChIKey | JUFBUNCMEQBNII-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 100.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.67 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|