C46H39BrN6O5 — CID 67823238
1-acetyloxyethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-5-methylimidazole-4-carboxylate (PubChem CID 67823238) has the molecular formula C46H39BrN6O5 and a molecular weight of 835.76 g/mol. Its IUPAC name is 1-acetyloxyethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-5-methylimidazole-4-carboxylate.
| Compound Name | 1-acetyloxyethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-5-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 67823238 |
| Molecular Formula | C46H39BrN6O5 |
| Molecular Weight | 835.76 g/mol |
| Exact Mass | 834.22 |
| IUPAC Name | 1-acetyloxyethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethyl-5-methylimidazole-4-carboxylate |
| SMILES | CCc1nc(C)c(C(=O)OC(C)OC(C)=O)n1Cc1c2ccocc-2c(Br)c1-c1ccccc1-c1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C46H39BrN6O5/c1-5-40-48-29(2)43(45(55)58-31(4)57-30(3)54)52(40)27-38-35-25-26-56-28-39(35)42(47)41(38)36-23-15-16-24-37(36)44-49-51-53(50-44)46(32-17-9-6-10-18-32,33-19-11-7-12-20-33)34-21-13-8-14-22-34/h6-26,28,31H,5,27H2,1-4H3 |
| InChIKey | WWZBJCPOFCYXST-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 127.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.76 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|