C48H45BrN6O3 — CID 67822911
ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-butyl-5-propylimidazole-4-carboxylate (PubChem CID 67822911) has the molecular formula C48H45BrN6O3 and a molecular weight of 833.83 g/mol. Its IUPAC name is ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-butyl-5-propylimidazole-4-carboxylate.
| Compound Name | ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-butyl-5-propylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 67822911 |
| Molecular Formula | C48H45BrN6O3 |
| Molecular Weight | 833.83 g/mol |
| Exact Mass | 832.27 |
| IUPAC Name | ethyl 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-butyl-5-propylimidazole-4-carboxylate |
| SMILES | CCCCc1nc(CCC)c(C(=O)OCC)n1Cc1c2ccocc-2c(Br)c1-c1ccccc1-c1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C48H45BrN6O3/c1-4-7-28-42-50-41(19-5-2)45(47(56)58-6-3)54(42)31-39-36-29-30-57-32-40(36)44(49)43(39)37-26-17-18-27-38(37)46-51-53-55(52-46)48(33-20-11-8-12-21-33,34-22-13-9-14-23-34)35-24-15-10-16-25-35/h8-18,20-27,29-30,32H,4-7,19,28,31H2,1-3H3 |
| InChIKey | GMKXZRZNSMITMG-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 100.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.83 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|