C50H45BrClN7O4 — CID 88501200
ethyl 1-[3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-2-butyl-5-chloroimidazole-4-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 88501200) has the molecular formula C50H45BrClN7O4 and a molecular weight of 923.31 g/mol. Its IUPAC name is ethyl 1-[3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-2-butyl-5-chloroimidazole-4-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-2-butyl-5-chloroimidazole-4-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88501200 |
| Molecular Formula | C50H45BrClN7O4 |
| Molecular Weight | 923.31 g/mol |
| Exact Mass | 921.24 |
| IUPAC Name | ethyl 1-[3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-2-butyl-5-chloroimidazole-4-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)N2CCCC2C(=O)OCC)n1Cc1ccc2oc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(Br)c2c1 |
| InChI | InChI=1S/C50H45BrClN7O4/c1-3-5-27-42-53-46(52)44(48(60)57-30-17-26-40(57)49(61)62-4-2)58(42)32-33-28-29-41-39(31-33)43(51)45(63-41)37-24-15-16-25-38(37)47-54-56-59(55-47)50(34-18-9-6-10-19-34,35-20-11-7-12-21-35)36-22-13-8-14-23-36/h6-16,18-25,28-29,31,40H,3-5,17,26-27,30,32H2,1-2H3 |
| InChIKey | QQIUHPXMNKNFRM-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 121.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.31 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|