C40H26BrClN6O4 — CID 88526280
3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5-chloro-2-formylimidazole-4-carboxylic acid (PubChem CID 88526280) has the molecular formula C40H26BrClN6O4 and a molecular weight of 770.04 g/mol. Its IUPAC name is 3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5-chloro-2-formylimidazole-4-carboxylic acid.
| Compound Name | 3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5-chloro-2-formylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 88526280 |
| Molecular Formula | C40H26BrClN6O4 |
| Molecular Weight | 770.04 g/mol |
| Exact Mass | 768.09 |
| IUPAC Name | 3-[[3-bromo-2-[2-(2-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5-chloro-2-formylimidazole-4-carboxylic acid |
| SMILES | O=Cc1nc(Cl)c(C(=O)O)n1Cc1ccc2oc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(Br)c2c1 |
| InChI | InChI=1S/C40H26BrClN6O4/c41-34-31-22-25(23-47-33(24-49)43-37(42)35(47)39(50)51)20-21-32(31)52-36(34)29-18-10-11-19-30(29)38-44-46-48(45-38)40(26-12-4-1-5-13-26,27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-22,24H,23H2,(H,50,51) |
| InChIKey | ADXFMWPHDQDLSY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.04 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|