C36H26Br2N4O — CID 174314105
5-[2-[3-bromo-5-(2-bromoethyl)-1-benzofuran-2-yl]phenyl]-2-trityltetrazole (PubChem CID 174314105) has the molecular formula C36H26Br2N4O and a molecular weight of 690.44 g/mol. Its IUPAC name is 5-[2-[3-bromo-5-(2-bromoethyl)-1-benzofuran-2-yl]phenyl]-2-trityltetrazole.
| Compound Name | 5-[2-[3-bromo-5-(2-bromoethyl)-1-benzofuran-2-yl]phenyl]-2-trityltetrazole |
|---|---|
| PubChem CID | 174314105 |
| Molecular Formula | C36H26Br2N4O |
| Molecular Weight | 690.44 g/mol |
| Exact Mass | 688.05 |
| IUPAC Name | 5-[2-[3-bromo-5-(2-bromoethyl)-1-benzofuran-2-yl]phenyl]-2-trityltetrazole |
| SMILES | BrCCc1ccc2oc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(Br)c2c1 |
| InChI | InChI=1S/C36H26Br2N4O/c37-23-22-25-20-21-32-31(24-25)33(38)34(43-32)29-18-10-11-19-30(29)35-39-41-42(40-35)36(26-12-4-1-5-13-26,27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-21,24H,22-23H2 |
| InChIKey | YMJVOJUYYVRBTB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.44 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|