C20H18Br2O3 — CID 11754263
tert-butyl 2-[3-bromo-5-(bromomethyl)-1-benzofuran-2-yl]benzoate (PubChem CID 11754263) has the molecular formula C20H18Br2O3 and a molecular weight of 466.17 g/mol. Its IUPAC name is tert-butyl 2-[3-bromo-5-(bromomethyl)-1-benzofuran-2-yl]benzoate.
| Compound Name | tert-butyl 2-[3-bromo-5-(bromomethyl)-1-benzofuran-2-yl]benzoate |
|---|---|
| PubChem CID | 11754263 |
| Molecular Formula | C20H18Br2O3 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | tert-butyl 2-[3-bromo-5-(bromomethyl)-1-benzofuran-2-yl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccccc1-c1oc2ccc(CBr)cc2c1Br |
| InChI | InChI=1S/C20H18Br2O3/c1-20(2,3)25-19(23)14-7-5-4-6-13(14)18-17(22)15-10-12(11-21)8-9-16(15)24-18/h4-10H,11H2,1-3H3 |
| InChIKey | VHYYYCWZCRJQFC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|