C31H26BrClN2O4 — CID 19026324
benzyl 2-[3-bromo-5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-1-benzofuran-2-yl]benzoate (PubChem CID 19026324) has the molecular formula C31H26BrClN2O4 and a molecular weight of 605.92 g/mol. Its IUPAC name is benzyl 2-[3-bromo-5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-1-benzofuran-2-yl]benzoate.
| Compound Name | benzyl 2-[3-bromo-5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-1-benzofuran-2-yl]benzoate |
|---|---|
| PubChem CID | 19026324 |
| Molecular Formula | C31H26BrClN2O4 |
| Molecular Weight | 605.92 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | benzyl 2-[3-bromo-5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-1-benzofuran-2-yl]benzoate |
| SMILES | CCCCc1nc(Cl)c(C=O)n1Cc1ccc2oc(-c3ccccc3C(=O)OCc3ccccc3)c(Br)c2c1 |
| InChI | InChI=1S/C31H26BrClN2O4/c1-2-3-13-27-34-30(33)25(18-36)35(27)17-21-14-15-26-24(16-21)28(32)29(39-26)22-11-7-8-12-23(22)31(37)38-19-20-9-5-4-6-10-20/h4-12,14-16,18H,2-3,13,17,19H2,1H3 |
| InChIKey | XGZBGNFLGGJIRF-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.92 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|