C27H26ClN5O4S — CID 54470043
[5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-2-(2-pyridin-2-ylphenyl)phenyl]sulfonylurea (PubChem CID 54470043) has the molecular formula C27H26ClN5O4S and a molecular weight of 552.06 g/mol. Its IUPAC name is [5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-2-(2-pyridin-2-ylphenyl)phenyl]sulfonylurea.
| Compound Name | [5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-2-(2-pyridin-2-ylphenyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 54470043 |
| Molecular Formula | C27H26ClN5O4S |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | [5-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]-2-(2-pyridin-2-ylphenyl)phenyl]sulfonylurea |
| SMILES | CCCCc1nc(Cl)c(C=O)n1Cc1ccc(-c2ccccc2-c2ccccn2)c(S(=O)(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C27H26ClN5O4S/c1-2-3-11-25-31-26(28)23(17-34)33(25)16-18-12-13-21(24(15-18)38(36,37)32-27(29)35)19-8-4-5-9-20(19)22-10-6-7-14-30-22/h4-10,12-15,17H,2-3,11,16H2,1H3,(H3,29,32,35) |
| InChIKey | XHROLSNDPAVUCW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|