C35H26BrN5 — CID 67941314
3-bromo-5-methyl-2-[2-(2-trityltetrazol-5-yl)phenyl]-1H-indole (PubChem CID 67941314) has the molecular formula C35H26BrN5 and a molecular weight of 596.53 g/mol. Its IUPAC name is 3-bromo-5-methyl-2-[2-(2-trityltetrazol-5-yl)phenyl]-1H-indole.
| Compound Name | 3-bromo-5-methyl-2-[2-(2-trityltetrazol-5-yl)phenyl]-1H-indole |
|---|---|
| PubChem CID | 67941314 |
| Molecular Formula | C35H26BrN5 |
| Molecular Weight | 596.53 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | 3-bromo-5-methyl-2-[2-(2-trityltetrazol-5-yl)phenyl]-1H-indole |
| SMILES | Cc1ccc2[nH]c(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(Br)c2c1 |
| InChI | InChI=1S/C35H26BrN5/c1-24-21-22-31-30(23-24)32(36)33(37-31)28-19-11-12-20-29(28)34-38-40-41(39-34)35(25-13-5-2-6-14-25,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-23,37H,1H3 |
| InChIKey | FPBDEAVCLHEZQR-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.53 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|