C42H41N6O+ — CID 67662718
[1-butyl-1,5-dimethyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-yl]methanol (PubChem CID 67662718) has the molecular formula C42H41N6O+ and a molecular weight of 645.83 g/mol. Its IUPAC name is [1-butyl-1,5-dimethyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-yl]methanol.
| Compound Name | [1-butyl-1,5-dimethyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-yl]methanol |
|---|---|
| PubChem CID | 67662718 |
| Molecular Formula | C42H41N6O+ |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | [1-butyl-1,5-dimethyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-yl]methanol |
| SMILES | CCCC[N+]1(C)N=C(c2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)C(CO)=C1C |
| InChI | InChI=1S/C42H41N6O/c1-4-5-29-48(3)31(2)39(30-49)40(45-48)33-27-25-32(26-28-33)37-23-15-16-24-38(37)41-43-46-47(44-41)42(34-17-9-6-10-18-34,35-19-11-7-12-20-35)36-21-13-8-14-22-36/h6-28,49H,4-5,29-30H2,1-3H3/q+1 |
| InChIKey | WAXKZCMRNINXJO-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|