C73H61N10+ — CID 71653011
5-[2-[4-[[2-butyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-1-ium-1-yl]methyl]phenyl]phenyl]-2-trityltetrazole (PubChem CID 71653011) has the molecular formula C73H61N10+ and a molecular weight of 1078.36 g/mol. Its IUPAC name is 5-[2-[4-[[2-butyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-1-ium-1-yl]methyl]phenyl]phenyl]-2-trityltetrazole.
| Compound Name | 5-[2-[4-[[2-butyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-1-ium-1-yl]methyl]phenyl]phenyl]-2-trityltetrazole |
|---|---|
| PubChem CID | 71653011 |
| Molecular Formula | C73H61N10+ |
| Molecular Weight | 1078.36 g/mol |
| Exact Mass | 1077.51 |
| IUPAC Name | 5-[2-[4-[[2-butyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-1-ium-1-yl]methyl]phenyl]phenyl]-2-trityltetrazole |
| SMILES | CCCCc1n(Cc2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)cc[n+]1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C73H61N10/c1-2-3-42-69-80(53-55-43-47-57(48-44-55)65-38-22-24-40-67(65)70-74-78-82(76-70)72(59-26-10-4-11-27-59,60-28-12-5-13-29-60)61-30-14-6-15-31-61)51-52-81(69)54-56-45-49-58(50-46-56)66-39-23-25-41-68(66)71-75-79-83(77-71)73(62-32-16-7-17-33-62,63-34-18-8-19-35-63)64-36-20-9-21-37-64/h4-41,43-52H,2-3,42,53-54H2,1H3/q+1 |
| InChIKey | HESNARVPMNECBW-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 96.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.36 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|