C41H31BrN6O2 — CID 67892919
3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethylpyrimidin-4-one (PubChem CID 67892919) has the molecular formula C41H31BrN6O2 and a molecular weight of 719.64 g/mol. Its IUPAC name is 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethylpyrimidin-4-one.
| Compound Name | 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethylpyrimidin-4-one |
|---|---|
| PubChem CID | 67892919 |
| Molecular Formula | C41H31BrN6O2 |
| Molecular Weight | 719.64 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 3-[[7-bromo-6-[2-(2-trityltetrazol-5-yl)phenyl]cyclopenta[c]pyran-5-yl]methyl]-2-ethylpyrimidin-4-one |
| SMILES | CCc1nccc(=O)n1Cc1c2ccocc-2c(Br)c1-c1ccccc1-c1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C41H31BrN6O2/c1-2-36-43-24-22-37(49)47(36)26-34-31-23-25-50-27-35(31)39(42)38(34)32-20-12-13-21-33(32)40-44-46-48(45-40)41(28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-25,27H,2,26H2,1H3 |
| InChIKey | MFWKXVLVYMCMPS-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.64 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|