C32H31N5O — CID 101169586
N,N-diethyl-3-methyl-4-(2-trityltetrazol-5-yl)benzamide (PubChem CID 101169586) has the molecular formula C32H31N5O and a molecular weight of 501.63 g/mol. Its IUPAC name is N,N-diethyl-3-methyl-4-(2-trityltetrazol-5-yl)benzamide.
| Compound Name | N,N-diethyl-3-methyl-4-(2-trityltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 101169586 |
| Molecular Formula | C32H31N5O |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | N,N-diethyl-3-methyl-4-(2-trityltetrazol-5-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C32H31N5O/c1-4-36(5-2)31(38)25-21-22-29(24(3)23-25)30-33-35-37(34-30)32(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-23H,4-5H2,1-3H3 |
| InChIKey | HKPWJCSBYZKESP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|