C30H31N7 — CID 145432665
2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N'-hydrazinyl-4-phenylbenzenecarboximidamide (PubChem CID 145432665) has the molecular formula C30H31N7 and a molecular weight of 489.63 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N'-hydrazinyl-4-phenylbenzenecarboximidamide.
| Compound Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N'-hydrazinyl-4-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145432665 |
| Molecular Formula | C30H31N7 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-N'-hydrazinyl-4-phenylbenzenecarboximidamide |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2cc(-c3ccccc3)ccc2/C(N)=N/NN)cc1 |
| InChI | InChI=1S/C30H31N7/c1-4-27-34-28-19(2)16-20(3)33-30(28)37(27)18-21-10-12-23(13-11-21)26-17-24(22-8-6-5-7-9-22)14-15-25(26)29(31)35-36-32/h5-17,36H,4,18,32H2,1-3H3,(H2,31,35) |
| InChIKey | QDKMUVACRZRFKS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|