C29H32N8 — CID 145432506
N'-amino-4-(3,4-dimethylpyrazol-1-yl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide (PubChem CID 145432506) has the molecular formula C29H32N8 and a molecular weight of 492.63 g/mol. Its IUPAC name is N'-amino-4-(3,4-dimethylpyrazol-1-yl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-amino-4-(3,4-dimethylpyrazol-1-yl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145432506 |
| Molecular Formula | C29H32N8 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | N'-amino-4-(3,4-dimethylpyrazol-1-yl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2cc(-n3cc(C)c(C)n3)ccc2/C(N)=N/N)cc1 |
| InChI | InChI=1S/C29H32N8/c1-6-26-33-27-17(2)13-19(4)32-29(27)36(26)16-21-7-9-22(10-8-21)25-14-23(11-12-24(25)28(30)34-31)37-15-18(3)20(5)35-37/h7-15H,6,16,31H2,1-5H3,(H2,30,34) |
| InChIKey | QAEVNPACQCDOHR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|