C43H42N8 — CID 145432635
4-amino-N'-[amino(trityl)amino]-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide (PubChem CID 145432635) has the molecular formula C43H42N8 and a molecular weight of 670.87 g/mol. Its IUPAC name is 4-amino-N'-[amino(trityl)amino]-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide.
| Compound Name | 4-amino-N'-[amino(trityl)amino]-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145432635 |
| Molecular Formula | C43H42N8 |
| Molecular Weight | 670.87 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | 4-amino-N'-[amino(trityl)amino]-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzenecarboximidamide |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2cc(N)ccc2/C(N)=N/N(N)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H42N8/c1-4-39-48-40-29(2)26-30(3)47-42(40)50(39)28-31-20-22-32(23-21-31)38-27-36(44)24-25-37(38)41(45)49-51(46)43(33-14-8-5-9-15-33,34-16-10-6-11-17-34)35-18-12-7-13-19-35/h5-27H,4,28,44,46H2,1-3H3,(H2,45,49) |
| InChIKey | MCMZHBKNDIQOLN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|