C30H28N4O3S — CID 21470210
3-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 21470210) has the molecular formula C30H28N4O3S and a molecular weight of 524.65 g/mol. Its IUPAC name is 3-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 3-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 21470210 |
| Molecular Formula | C30H28N4O3S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 3-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2ccccc2N(C(=O)c2ccccc2)S(=O)O)cc1 |
| InChI | InChI=1S/C30H28N4O3S/c1-4-27-32-28-20(2)18-21(3)31-29(28)33(27)19-22-14-16-23(17-15-22)25-12-8-9-13-26(25)34(38(36)37)30(35)24-10-6-5-7-11-24/h5-18H,4,19H2,1-3H3,(H,36,37) |
| InChIKey | YJFTVLKZMPIKEY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|