C28H28BrN3O2 — CID 19425826
ethyl (E)-2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylprop-2-enoate (PubChem CID 19425826) has the molecular formula C28H28BrN3O2 and a molecular weight of 518.46 g/mol. Its IUPAC name is ethyl (E)-2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 19425826 |
| Molecular Formula | C28H28BrN3O2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | ethyl (E)-2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(Br)=C(/c1ccccc1)c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1 |
| InChI | InChI=1S/C28H28BrN3O2/c1-5-23-31-26-18(3)16-19(4)30-27(26)32(23)17-20-12-14-22(15-13-20)24(21-10-8-7-9-11-21)25(29)28(33)34-6-2/h7-16H,5-6,17H2,1-4H3/b25-24+ |
| InChIKey | VKSVNYPVZBGTPS-OCOZRVBESA-N |
| XLogP | 6.38 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|