C26H33N3O4 — CID 10647248
diethyl 2-[1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]ethyl]propanedioate (PubChem CID 10647248) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is diethyl 2-[1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-[1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 10647248 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | diethyl 2-[1-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-7-21-28-23-16(4)14-17(5)27-24(23)29(21)15-19-10-12-20(13-11-19)18(6)22(25(30)32-8-2)26(31)33-9-3/h10-14,18,22H,7-9,15H2,1-6H3 |
| InChIKey | VXBKORZFMUTLQM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|