C27H27N3O4 — CID 10527834
2-[[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-phenylmethyl]propanedioic acid (PubChem CID 10527834) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-phenylmethyl]propanedioic acid.
| Compound Name | 2-[[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-phenylmethyl]propanedioic acid |
|---|---|
| PubChem CID | 10527834 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-phenylmethyl]propanedioic acid |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(C(c2ccccc2)C(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-4-21-29-24-16(2)14-17(3)28-25(24)30(21)15-18-10-12-20(13-11-18)22(19-8-6-5-7-9-19)23(26(31)32)27(33)34/h5-14,22-23H,4,15H2,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | JISAPBDUWUKPNW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|