C31H32ClN3O4 — CID 10721284
diethyl 2-[(2-chlorophenyl)-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]methylidene]propanedioate (PubChem CID 10721284) has the molecular formula C31H32ClN3O4 and a molecular weight of 546.07 g/mol. Its IUPAC name is diethyl 2-[(2-chlorophenyl)-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]methylidene]propanedioate.
| Compound Name | diethyl 2-[(2-chlorophenyl)-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 10721284 |
| Molecular Formula | C31H32ClN3O4 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | diethyl 2-[(2-chlorophenyl)-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C(c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C31H32ClN3O4/c1-6-25-34-28-19(4)17-20(5)33-29(28)35(25)18-21-13-15-22(16-14-21)26(23-11-9-10-12-24(23)32)27(30(36)38-7-2)31(37)39-8-3/h9-17H,6-8,18H2,1-5H3 |
| InChIKey | GWEJXWPDATXFGY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|