C36H39N3O3S — CID 54499907
1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2,6-dibutyl-4-methylpyrrolo[2,3-b]pyridine (PubChem CID 54499907) has the molecular formula C36H39N3O3S and a molecular weight of 593.79 g/mol. Its IUPAC name is 1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2,6-dibutyl-4-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2,6-dibutyl-4-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 54499907 |
| Molecular Formula | C36H39N3O3S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2,6-dibutyl-4-methylpyrrolo[2,3-b]pyridine |
| SMILES | CCCCc1cc(C)c2cc(CCCC)n(Cc3ccc(-c4ccccc4N(C(=O)c4ccccc4)S(=O)O)cc3)c2n1 |
| InChI | InChI=1S/C36H39N3O3S/c1-4-6-15-30-23-26(3)33-24-31(16-7-5-2)38(35(33)37-30)25-27-19-21-28(22-20-27)32-17-11-12-18-34(32)39(43(41)42)36(40)29-13-9-8-10-14-29/h8-14,17-24H,4-7,15-16,25H2,1-3H3,(H,41,42) |
| InChIKey | ORKSTBZOIONVFD-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|