C34H31N3O5S — CID 54392952
1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-cyclopropyl-6-ethoxycarbonyl-4-methylpyrrolo[2,3-b]pyridine (PubChem CID 54392952) has the molecular formula C34H31N3O5S and a molecular weight of 593.71 g/mol. Its IUPAC name is 1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-cyclopropyl-6-ethoxycarbonyl-4-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-cyclopropyl-6-ethoxycarbonyl-4-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 54392952 |
| Molecular Formula | C34H31N3O5S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 1-[[4-[2-[benzoyl(sulfino)amino]phenyl]phenyl]methyl]-2-cyclopropyl-6-ethoxycarbonyl-4-methylpyrrolo[2,3-b]pyridine |
| SMILES | CCOC(=O)c1cc(C)c2cc(C3CC3)n(Cc3ccc(-c4ccccc4N(C(=O)c4ccccc4)S(=O)O)cc3)c2n1 |
| InChI | InChI=1S/C34H31N3O5S/c1-3-42-34(39)29-19-22(2)28-20-31(25-17-18-25)36(32(28)35-29)21-23-13-15-24(16-14-23)27-11-7-8-12-30(27)37(43(40)41)33(38)26-9-5-4-6-10-26/h4-16,19-20,25H,3,17-18,21H2,1-2H3,(H,40,41) |
| InChIKey | OFARXOZYPZJISM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|