C32H33N4O5S2Si- — CID 54364029
3-[[4-[2-[benzoyl(sulfinato)amino]-5-trimethylsilylthiophen-3-yl]phenyl]methyl]-2-ethyl-5-methoxycarbonyl-7-methylimidazo[4,5-b]pyridine (PubChem CID 54364029) has the molecular formula C32H33N4O5S2Si- and a molecular weight of 645.86 g/mol. Its IUPAC name is 3-[[4-[2-[benzoyl(sulfinato)amino]-5-trimethylsilylthiophen-3-yl]phenyl]methyl]-2-ethyl-5-methoxycarbonyl-7-methylimidazo[4,5-b]pyridine.
| Compound Name | 3-[[4-[2-[benzoyl(sulfinato)amino]-5-trimethylsilylthiophen-3-yl]phenyl]methyl]-2-ethyl-5-methoxycarbonyl-7-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 54364029 |
| Molecular Formula | C32H33N4O5S2Si- |
| Molecular Weight | 645.86 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | 3-[[4-[2-[benzoyl(sulfinato)amino]-5-trimethylsilylthiophen-3-yl]phenyl]methyl]-2-ethyl-5-methoxycarbonyl-7-methylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C(=O)OC)nc2n1Cc1ccc(-c2cc([Si](C)(C)C)sc2N(C(=O)c2ccccc2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C32H34N4O5S2Si/c1-7-26-34-28-20(2)17-25(32(38)41-3)33-29(28)35(26)19-21-13-15-22(16-14-21)24-18-27(44(4,5)6)42-31(24)36(43(39)40)30(37)23-11-9-8-10-12-23/h8-18H,7,19H2,1-6H3,(H,39,40)/p-1 |
| InChIKey | DMHLXDBMHJWPQD-UHFFFAOYSA-M |
| XLogP | 5.85 |
| TPSA | 117.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.86 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|